C17H28N2O3S — CID 94821438
(2R)-N-[(2R)-2-(dimethylamino)-2-(4-methylphenyl)ethyl]-2-propan-2-ylsulfonylpropanamide (PubChem CID 94821438) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is (2R)-N-[(2R)-2-(dimethylamino)-2-(4-methylphenyl)ethyl]-2-propan-2-ylsulfonylpropanamide.
| Compound Name | (2R)-N-[(2R)-2-(dimethylamino)-2-(4-methylphenyl)ethyl]-2-propan-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 94821438 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2R)-N-[(2R)-2-(dimethylamino)-2-(4-methylphenyl)ethyl]-2-propan-2-ylsulfonylpropanamide |
| SMILES | Cc1ccc([C@H](CNC(=O)[C@@H](C)S(=O)(=O)C(C)C)N(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O3S/c1-12(2)23(21,22)14(4)17(20)18-11-16(19(5)6)15-9-7-13(3)8-10-15/h7-10,12,14,16H,11H2,1-6H3,(H,18,20)/t14-,16+/m1/s1 |
| InChIKey | ACJXCDKCGPSURS-ZBFHGGJFSA-N |
| XLogP | 1.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |