C16H27N3O — CID 60597801
3-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]-1,1-diethylurea (PubChem CID 60597801) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]-1,1-diethylurea.
| Compound Name | 3-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 60597801 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 3-[2-(dimethylamino)-2-(4-methylphenyl)ethyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)NCC(c1ccc(C)cc1)N(C)C |
| InChI | InChI=1S/C16H27N3O/c1-6-19(7-2)16(20)17-12-15(18(4)5)14-10-8-13(3)9-11-14/h8-11,15H,6-7,12H2,1-5H3,(H,17,20) |
| InChIKey | ZTLMURQOWGWBAQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |