C11H21NO — CID 10631320
2-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]ethanol (PubChem CID 10631320) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 2-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]ethanol.
| Compound Name | 2-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]ethanol |
|---|---|
| PubChem CID | 10631320 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-[(5S,8R,8aS)-8-methyl-1,2,3,5,6,7,8,8a-octahydroindolizin-5-yl]ethanol |
| SMILES | C[C@@H]1CC[C@@H](CCO)N2CCC[C@@H]12 |
| InChI | InChI=1S/C11H21NO/c1-9-4-5-10(6-8-13)12-7-2-3-11(9)12/h9-11,13H,2-8H2,1H3/t9-,10+,11+/m1/s1 |
| InChIKey | GJKLCTIPNNPPIM-VWYCJHECSA-N |
| XLogP | 1.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |