C12H20N2O — CID 106313747
(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-[(3S)-piperidin-3-yl]methanone (PubChem CID 106313747) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is (5-methyl-3,6-dihydro-2H-pyridin-1-yl)-[(3S)-piperidin-3-yl]methanone.
| Compound Name | (5-methyl-3,6-dihydro-2H-pyridin-1-yl)-[(3S)-piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 106313747 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (5-methyl-3,6-dihydro-2H-pyridin-1-yl)-[(3S)-piperidin-3-yl]methanone |
| SMILES | CC1=CCCN(C(=O)[C@H]2CCCNC2)C1 |
| InChI | InChI=1S/C12H20N2O/c1-10-4-3-7-14(9-10)12(15)11-5-2-6-13-8-11/h4,11,13H,2-3,5-9H2,1H3/t11-/m0/s1 |
| InChIKey | HWQHROOKHNGIFD-NSHDSACASA-N |
| XLogP | 1.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|