C12H20N2O2 — CID 106314010
(4-aminooxan-4-yl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 106314010) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is (4-aminooxan-4-yl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (4-aminooxan-4-yl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 106314010 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (4-aminooxan-4-yl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CC1=CCCN(C(=O)C2(N)CCOCC2)C1 |
| InChI | InChI=1S/C12H20N2O2/c1-10-3-2-6-14(9-10)11(15)12(13)4-7-16-8-5-12/h3H,2,4-9,13H2,1H3 |
| InChIKey | ULKQBNAQXMZIKB-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|