C13H13FINO — CID 106314285
(4-fluoro-2-iodophenyl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 106314285) has the molecular formula C13H13FINO and a molecular weight of 345.16 g/mol. Its IUPAC name is (4-fluoro-2-iodophenyl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (4-fluoro-2-iodophenyl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 106314285 |
| Molecular Formula | C13H13FINO |
| Molecular Weight | 345.16 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | (4-fluoro-2-iodophenyl)-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CC1=CCCN(C(=O)c2ccc(F)cc2I)C1 |
| InChI | InChI=1S/C13H13FINO/c1-9-3-2-6-16(8-9)13(17)11-5-4-10(14)7-12(11)15/h3-5,7H,2,6,8H2,1H3 |
| InChIKey | KYNVHMPBEPDFBI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|