C13H15FN2O3S — CID 106316195
4-fluoro-2-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzenesulfonamide (PubChem CID 106316195) has the molecular formula C13H15FN2O3S and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-fluoro-2-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzenesulfonamide.
| Compound Name | 4-fluoro-2-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106316195 |
| Molecular Formula | C13H15FN2O3S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 4-fluoro-2-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)benzenesulfonamide |
| SMILES | CC1=CCCN(C(=O)c2cc(F)ccc2S(N)(=O)=O)C1 |
| InChI | InChI=1S/C13H15FN2O3S/c1-9-3-2-6-16(8-9)13(17)11-7-10(14)4-5-12(11)20(15,18)19/h3-5,7H,2,6,8H2,1H3,(H2,15,18,19) |
| InChIKey | TULGSWBFZDKIAO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|