C11H15ClN4O2S2 — CID 106314448
1-(4-chloro-1-methylpyrazol-5-yl)sulfonyl-4-methylsulfanylpiperidine-4-carbonitrile (PubChem CID 106314448) has the molecular formula C11H15ClN4O2S2 and a molecular weight of 334.85 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)sulfonyl-4-methylsulfanylpiperidine-4-carbonitrile.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)sulfonyl-4-methylsulfanylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 106314448 |
| Molecular Formula | C11H15ClN4O2S2 |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)sulfonyl-4-methylsulfanylpiperidine-4-carbonitrile |
| SMILES | CSC1(C#N)CCN(S(=O)(=O)c2c(Cl)cnn2C)CC1 |
| InChI | InChI=1S/C11H15ClN4O2S2/c1-15-10(9(12)7-14-15)20(17,18)16-5-3-11(8-13,19-2)4-6-16/h7H,3-6H2,1-2H3 |
| InChIKey | YNRFUXHBXLGBJS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |