C14H26N2 — CID 106314928
[2-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclohexyl]methanamine (PubChem CID 106314928) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is [2-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclohexyl]methanamine.
| Compound Name | [2-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 106314928 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | [2-[(5-methyl-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclohexyl]methanamine |
| SMILES | CC1=CCCN(CC2CCCCC2CN)C1 |
| InChI | InChI=1S/C14H26N2/c1-12-5-4-8-16(10-12)11-14-7-3-2-6-13(14)9-15/h5,13-14H,2-4,6-11,15H2,1H3 |
| InChIKey | BMSISRQWECQEEU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|