C10H20N2O — CID 106315046
2-[2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)ethoxy]ethanamine (PubChem CID 106315046) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-[2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)ethoxy]ethanamine.
| Compound Name | 2-[2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 106315046 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-[2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)ethoxy]ethanamine |
| SMILES | CC1=CCCN(CCOCCN)C1 |
| InChI | InChI=1S/C10H20N2O/c1-10-3-2-5-12(9-10)6-8-13-7-4-11/h3H,2,4-9,11H2,1H3 |
| InChIKey | BHLPNGJSWCVYEN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|