C22H40N2O — CID 72671730
3,7,11-trimethyl-N-(3-morpholin-4-ylpropyl)dodeca-2,6,10-trien-1-amine (PubChem CID 72671730) has the molecular formula C22H40N2O and a molecular weight of 348.58 g/mol. Its IUPAC name is 3,7,11-trimethyl-N-(3-morpholin-4-ylpropyl)dodeca-2,6,10-trien-1-amine.
| Compound Name | 3,7,11-trimethyl-N-(3-morpholin-4-ylpropyl)dodeca-2,6,10-trien-1-amine |
|---|---|
| PubChem CID | 72671730 |
| Molecular Formula | C22H40N2O |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.31 |
| IUPAC Name | 3,7,11-trimethyl-N-(3-morpholin-4-ylpropyl)dodeca-2,6,10-trien-1-amine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCNCCCN1CCOCC1 |
| InChI | InChI=1S/C22H40N2O/c1-20(2)8-5-9-21(3)10-6-11-22(4)12-14-23-13-7-15-24-16-18-25-19-17-24/h8,10,12,23H,5-7,9,11,13-19H2,1-4H3 |
| InChIKey | LJZJVPBSOSBLOL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|