C17H30N2O2 — CID 72671758
3,7-dimethyl-N-(3-morpholin-4-ylpropyl)octa-2,6-dienamide (PubChem CID 72671758) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 3,7-dimethyl-N-(3-morpholin-4-ylpropyl)octa-2,6-dienamide.
| Compound Name | 3,7-dimethyl-N-(3-morpholin-4-ylpropyl)octa-2,6-dienamide |
|---|---|
| PubChem CID | 72671758 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 3,7-dimethyl-N-(3-morpholin-4-ylpropyl)octa-2,6-dienamide |
| SMILES | CC(C)=CCCC(C)=CC(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C17H30N2O2/c1-15(2)6-4-7-16(3)14-17(20)18-8-5-9-19-10-12-21-13-11-19/h6,14H,4-5,7-13H2,1-3H3,(H,18,20) |
| InChIKey | RCKQMYACOCDYKC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|