C26H44N2O2 — CID 21297962
(2E,6E,10E)-3,7,11,15-tetramethyl-N-(1-morpholin-4-ylethyl)hexadeca-2,6,10,14-tetraenamide (PubChem CID 21297962) has the molecular formula C26H44N2O2 and a molecular weight of 416.65 g/mol. Its IUPAC name is (2E,6E,10E)-3,7,11,15-tetramethyl-N-(1-morpholin-4-ylethyl)hexadeca-2,6,10,14-tetraenamide.
| Compound Name | (2E,6E,10E)-3,7,11,15-tetramethyl-N-(1-morpholin-4-ylethyl)hexadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 21297962 |
| Molecular Formula | C26H44N2O2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.34 |
| IUPAC Name | (2E,6E,10E)-3,7,11,15-tetramethyl-N-(1-morpholin-4-ylethyl)hexadeca-2,6,10,14-tetraenamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C(=O)NC(C)N1CCOCC1 |
| InChI | InChI=1S/C26H44N2O2/c1-21(2)10-7-11-22(3)12-8-13-23(4)14-9-15-24(5)20-26(29)27-25(6)28-16-18-30-19-17-28/h10,12,14,20,25H,7-9,11,13,15-19H2,1-6H3,(H,27,29)/b22-12+,23-14+,24-20+ |
| InChIKey | GKKVNBYSKZMERC-AIMTVMDNSA-N |
| XLogP | 5.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|