C16H20N2O3 — CID 106315741
2-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]-3-phenylpropanoic acid (PubChem CID 106315741) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]-3-phenylpropanoic acid.
| Compound Name | 2-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 106315741 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)amino]-3-phenylpropanoic acid |
| SMILES | CC1=CCCN(C(=O)NC(Cc2ccccc2)C(=O)O)C1 |
| InChI | InChI=1S/C16H20N2O3/c1-12-6-5-9-18(11-12)16(21)17-14(15(19)20)10-13-7-3-2-4-8-13/h2-4,6-8,14H,5,9-11H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | YQTLIQUBQUWPOC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|