C14H21NO3 — CID 106316277
3-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexane-1-carboxylic acid (PubChem CID 106316277) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106316277 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CC1=CCCN(C(=O)C2CCCC(C(=O)O)C2)C1 |
| InChI | InChI=1S/C14H21NO3/c1-10-4-3-7-15(9-10)13(16)11-5-2-6-12(8-11)14(17)18/h4,11-12H,2-3,5-9H2,1H3,(H,17,18) |
| InChIKey | OAOCFQMXGBZTES-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|