C11H18N2O — CID 106313552
(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-pyrrolidin-1-ylmethanone (PubChem CID 106313552) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (5-methyl-3,6-dihydro-2H-pyridin-1-yl)-pyrrolidin-1-ylmethanone.
| Compound Name | (5-methyl-3,6-dihydro-2H-pyridin-1-yl)-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 106313552 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (5-methyl-3,6-dihydro-2H-pyridin-1-yl)-pyrrolidin-1-ylmethanone |
| SMILES | CC1=CCCN(C(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C11H18N2O/c1-10-5-4-8-13(9-10)11(14)12-6-2-3-7-12/h5H,2-4,6-9H2,1H3 |
| InChIKey | KGTJLWSYUNZIHR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|