C13H20N2O3 — CID 114172600
2-[1-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)azetidin-3-yl]propanoic acid (PubChem CID 114172600) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[1-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)azetidin-3-yl]propanoic acid.
| Compound Name | 2-[1-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)azetidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 114172600 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-[1-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)azetidin-3-yl]propanoic acid |
| SMILES | CC1=CCCN(C(=O)N2CC(C(C)C(=O)O)C2)C1 |
| InChI | InChI=1S/C13H20N2O3/c1-9-4-3-5-14(6-9)13(18)15-7-11(8-15)10(2)12(16)17/h4,10-11H,3,5-8H2,1-2H3,(H,16,17) |
| InChIKey | MCEFKCYXMQNQEV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|