C12H18N2O2 — CID 106316310
5-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)piperidin-2-one (PubChem CID 106316310) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)piperidin-2-one.
| Compound Name | 5-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)piperidin-2-one |
|---|---|
| PubChem CID | 106316310 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 5-(5-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)piperidin-2-one |
| SMILES | CC1=CCCN(C(=O)C2CCC(=O)NC2)C1 |
| InChI | InChI=1S/C12H18N2O2/c1-9-3-2-6-14(8-9)12(16)10-4-5-11(15)13-7-10/h3,10H,2,4-8H2,1H3,(H,13,15) |
| InChIKey | IXOLZAZZXXVRAS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|