C19H30F3N3O2 — CID 166391649
N-[(Z)-4-(5-methylhex-4-enoylamino)but-2-enyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 166391649) has the molecular formula C19H30F3N3O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[(Z)-4-(5-methylhex-4-enoylamino)but-2-enyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | N-[(Z)-4-(5-methylhex-4-enoylamino)but-2-enyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 166391649 |
| Molecular Formula | C19H30F3N3O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | N-[(Z)-4-(5-methylhex-4-enoylamino)but-2-enyl]-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | CC(C)=CCCC(=O)NC/C=C\CNC(=O)C1CCCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C19H30F3N3O2/c1-15(2)7-5-9-17(26)23-10-3-4-11-24-18(27)16-8-6-12-25(13-16)14-19(20,21)22/h3-4,7,16H,5-6,8-14H2,1-2H3,(H,23,26)(H,24,27)/b4-3- |
| InChIKey | SLSZTGJOLJHYGE-ARJAWSKDSA-N |
| XLogP | 2.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|