C13H18N2O — CID 106316371
[2-methyl-6-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methanol (PubChem CID 106316371) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is [2-methyl-6-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methanol.
| Compound Name | [2-methyl-6-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 106316371 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | [2-methyl-6-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methanol |
| SMILES | CC1=CCCN(c2ccc(CO)c(C)n2)C1 |
| InChI | InChI=1S/C13H18N2O/c1-10-4-3-7-15(8-10)13-6-5-12(9-16)11(2)14-13/h4-6,16H,3,7-9H2,1-2H3 |
| InChIKey | PHIXGIZVNHBBJC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|