C14H20FN3 — CID 106316599
N-[[5-fluoro-2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methyl]ethanamine (PubChem CID 106316599) has the molecular formula C14H20FN3 and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[[5-fluoro-2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methyl]ethanamine.
| Compound Name | N-[[5-fluoro-2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 106316599 |
| Molecular Formula | C14H20FN3 |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | N-[[5-fluoro-2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-3-pyridinyl]methyl]ethanamine |
| SMILES | CCNCc1cc(F)cnc1N1CCC=C(C)C1 |
| InChI | InChI=1S/C14H20FN3/c1-3-16-8-12-7-13(15)9-17-14(12)18-6-4-5-11(2)10-18/h5,7,9,16H,3-4,6,8,10H2,1-2H3 |
| InChIKey | QAOVMELCRPVWOL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|