C18H27N3 — CID 106316607
N-[[2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-6-propyl-4-pyridinyl]methyl]cyclopropanamine (PubChem CID 106316607) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is N-[[2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-6-propyl-4-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-6-propyl-4-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106316607 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N-[[2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-6-propyl-4-pyridinyl]methyl]cyclopropanamine |
| SMILES | CCCc1cc(CNC2CC2)cc(N2CCC=C(C)C2)n1 |
| InChI | InChI=1S/C18H27N3/c1-3-5-17-10-15(12-19-16-7-8-16)11-18(20-17)21-9-4-6-14(2)13-21/h6,10-11,16,19H,3-5,7-9,12-13H2,1-2H3 |
| InChIKey | ITOFBWOITFGGLV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|