C12H23F3N2O — CID 106318659
N-methyl-1-[3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine (PubChem CID 106318659) has the molecular formula C12H23F3N2O and a molecular weight of 268.32 g/mol. Its IUPAC name is N-methyl-1-[3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine.
| Compound Name | N-methyl-1-[3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 106318659 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N-methyl-1-[3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrolidin-3-yl]methanamine |
| SMILES | CNCC1(C)CCN(CCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H23F3N2O/c1-11(8-16-2)4-6-17(9-11)5-3-7-18-10-12(13,14)15/h16H,3-10H2,1-2H3 |
| InChIKey | ZBPXCKCPDPQURY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|