C12H20F3NO3 — CID 63136364
3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-3-carboxylic acid (PubChem CID 63136364) has the molecular formula C12H20F3NO3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63136364 |
| Molecular Formula | C12H20F3NO3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 3-methyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCN(CCCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H20F3NO3/c1-11(10(17)18)4-2-5-16(8-11)6-3-7-19-9-12(13,14)15/h2-9H2,1H3,(H,17,18) |
| InChIKey | SZVHUOBKLFPSRC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|