C10H18N6OS — CID 106321678
1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N,3-dimethylpyrrolidine-3-carboxamide (PubChem CID 106321678) has the molecular formula C10H18N6OS and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N,3-dimethylpyrrolidine-3-carboxamide.
| Compound Name | 1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N,3-dimethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 106321678 |
| Molecular Formula | C10H18N6OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-N,3-dimethylpyrrolidine-3-carboxamide |
| SMILES | CNC(=O)C1(C)CCN(Cc2nnc(NN)s2)C1 |
| InChI | InChI=1S/C10H18N6OS/c1-10(8(17)12-2)3-4-16(6-10)5-7-14-15-9(13-11)18-7/h3-6,11H2,1-2H3,(H,12,17)(H,13,15) |
| InChIKey | GJIXFEUSZKULGJ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|