C10H19N5O2S — CID 114780204
[4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-6,6-dimethylmorpholin-2-yl]methanol (PubChem CID 114780204) has the molecular formula C10H19N5O2S and a molecular weight of 273.36 g/mol. Its IUPAC name is [4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-6,6-dimethylmorpholin-2-yl]methanol.
| Compound Name | [4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-6,6-dimethylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 114780204 |
| Molecular Formula | C10H19N5O2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | [4-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]-6,6-dimethylmorpholin-2-yl]methanol |
| SMILES | CC1(C)CN(Cc2nnc(NN)s2)CC(CO)O1 |
| InChI | InChI=1S/C10H19N5O2S/c1-10(2)6-15(3-7(5-16)17-10)4-8-13-14-9(12-11)18-8/h7,16H,3-6,11H2,1-2H3,(H,12,14) |
| InChIKey | PYFJPOZMBYSTFV-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|