C15H21NO3S — CID 114779546
3-[5-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol (PubChem CID 114779546) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 3-[5-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol.
| Compound Name | 3-[5-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 114779546 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-[5-[[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]methyl]thiophen-2-yl]prop-2-yn-1-ol |
| SMILES | CC1(C)CN(Cc2ccc(C#CCO)s2)CC(CO)O1 |
| InChI | InChI=1S/C15H21NO3S/c1-15(2)11-16(8-12(10-18)19-15)9-14-6-5-13(20-14)4-3-7-17/h5-6,12,17-18H,7-11H2,1-2H3 |
| InChIKey | XUUVRUUWRAMGJY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|