C12H17BrClNOS — CID 114780699
6-(bromomethyl)-4-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethylmorpholine (PubChem CID 114780699) has the molecular formula C12H17BrClNOS and a molecular weight of 338.70 g/mol. Its IUPAC name is 6-(bromomethyl)-4-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethylmorpholine.
| Compound Name | 6-(bromomethyl)-4-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114780699 |
| Molecular Formula | C12H17BrClNOS |
| Molecular Weight | 338.70 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 6-(bromomethyl)-4-[(5-chlorothiophen-2-yl)methyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(Cc2ccc(Cl)s2)CC(CBr)O1 |
| InChI | InChI=1S/C12H17BrClNOS/c1-12(2)8-15(6-9(5-13)16-12)7-10-3-4-11(14)17-10/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | LLKDQPYIUJORGD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.70 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|