About 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine
4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine (PubChem CID 114780762) has the molecular formula C14H18Br2FNO
and a molecular weight of 395.11 g/mol. Its IUPAC name is 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine |
| PubChem CID | 114780762 |
| Molecular Formula | C14H18Br2FNO |
| Molecular Weight | 395.11 g/mol |
| Exact Mass | 392.97 |
| IUPAC Name | 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(Cc2cc(F)cc(Br)c2)CC(CBr)O1 |
| InChI | InChI=1S/C14H18Br2FNO/c1-14(2)9-18(8-13(6-15)19-14)7-10-3-11(16)5-12(17)4-10/h3-5,13H,6-9H2,1-2H3 |
| InChIKey | GGEZSKKGUDDZML-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.11 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine?
The IUPAC name of 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine (CID 114780762) is 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine.
What is the SMILES notation for 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine?
The canonical SMILES for 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine is CC1(C)CN(Cc2cc(F)cc(Br)c2)CC(CBr)O1.
What is the InChIKey of 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine?
The InChIKey is GGEZSKKGUDDZML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18Br2FNO/c1-14(2)9-18(8-13(6-15)19-14)7-10-3-11(16)5-12(17)4-10/h3-5,13H,6-9H2,1-2H3.
What are the key properties of 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine?
4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine has a molecular weight of 395.11 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-bromo-5-fluorophenyl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine is sourced from PubChem (CID 114780762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).