C16H21Br2NO2 — CID 114780732
4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine (PubChem CID 114780732) has the molecular formula C16H21Br2NO2 and a molecular weight of 419.16 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine.
| Compound Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114780732 |
| Molecular Formula | C16H21Br2NO2 |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 416.99 |
| IUPAC Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(Cc2cc(Br)cc3c2OCC3)CC(CBr)O1 |
| InChI | InChI=1S/C16H21Br2NO2/c1-16(2)10-19(9-14(7-17)21-16)8-12-6-13(18)5-11-3-4-20-15(11)12/h5-6,14H,3-4,7-10H2,1-2H3 |
| InChIKey | ZQDWCFNITITSPY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|