C13H10BrNO3 — CID 104702958
1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]pyrrole-2,5-dione (PubChem CID 104702958) has the molecular formula C13H10BrNO3 and a molecular weight of 308.13 g/mol. Its IUPAC name is 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]pyrrole-2,5-dione.
| Compound Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 104702958 |
| Molecular Formula | C13H10BrNO3 |
| Molecular Weight | 308.13 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1Cc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C13H10BrNO3/c14-10-5-8-3-4-18-13(8)9(6-10)7-15-11(16)1-2-12(15)17/h1-2,5-6H,3-4,7H2 |
| InChIKey | GEFYLVKJCBHZAP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|