C13H12BrClN2O — CID 113403434
1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-(chloromethyl)imidazole (PubChem CID 113403434) has the molecular formula C13H12BrClN2O and a molecular weight of 327.61 g/mol. Its IUPAC name is 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-(chloromethyl)imidazole.
| Compound Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-(chloromethyl)imidazole |
|---|---|
| PubChem CID | 113403434 |
| Molecular Formula | C13H12BrClN2O |
| Molecular Weight | 327.61 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-(chloromethyl)imidazole |
| SMILES | ClCc1nccn1Cc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C13H12BrClN2O/c14-11-5-9-1-4-18-13(9)10(6-11)8-17-3-2-16-12(17)7-15/h2-3,5-6H,1,4,7-8H2 |
| InChIKey | VWFMLCAVXFIAOB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.61 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|