C17H13BrFNO — CID 116619794
1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-6-fluoroindole (PubChem CID 116619794) has the molecular formula C17H13BrFNO and a molecular weight of 346.20 g/mol. Its IUPAC name is 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-6-fluoroindole.
| Compound Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-6-fluoroindole |
|---|---|
| PubChem CID | 116619794 |
| Molecular Formula | C17H13BrFNO |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 1-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-6-fluoroindole |
| SMILES | Fc1ccc2ccn(Cc3cc(Br)cc4c3OCC4)c2c1 |
| InChI | InChI=1S/C17H13BrFNO/c18-14-7-12-4-6-21-17(12)13(8-14)10-20-5-3-11-1-2-15(19)9-16(11)20/h1-3,5,7-9H,4,6,10H2 |
| InChIKey | MCCMDHBUVMHDTK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |