C16H12BrFO3 — CID 107697879
2-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methoxy]-5-fluorobenzaldehyde (PubChem CID 107697879) has the molecular formula C16H12BrFO3 and a molecular weight of 351.17 g/mol. Its IUPAC name is 2-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methoxy]-5-fluorobenzaldehyde.
| Compound Name | 2-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methoxy]-5-fluorobenzaldehyde |
|---|---|
| PubChem CID | 107697879 |
| Molecular Formula | C16H12BrFO3 |
| Molecular Weight | 351.17 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methoxy]-5-fluorobenzaldehyde |
| SMILES | O=Cc1cc(F)ccc1OCc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C16H12BrFO3/c17-13-5-10-3-4-20-16(10)12(6-13)9-21-15-2-1-14(18)7-11(15)8-19/h1-2,5-8H,3-4,9H2 |
| InChIKey | DAENOKGJXQEOKS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.17 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|