C16H13BrClFO2 — CID 107691282
5-bromo-7-[[4-(chloromethyl)-2-fluorophenoxy]methyl]-2,3-dihydro-1-benzofuran (PubChem CID 107691282) has the molecular formula C16H13BrClFO2 and a molecular weight of 371.63 g/mol. Its IUPAC name is 5-bromo-7-[[4-(chloromethyl)-2-fluorophenoxy]methyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-bromo-7-[[4-(chloromethyl)-2-fluorophenoxy]methyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 107691282 |
| Molecular Formula | C16H13BrClFO2 |
| Molecular Weight | 371.63 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 5-bromo-7-[[4-(chloromethyl)-2-fluorophenoxy]methyl]-2,3-dihydro-1-benzofuran |
| SMILES | Fc1cc(CCl)ccc1OCc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C16H13BrClFO2/c17-13-6-11-3-4-20-16(11)12(7-13)9-21-15-2-1-10(8-18)5-14(15)19/h1-2,5-7H,3-4,8-9H2 |
| InChIKey | SWFYYOBKLZLHRE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|