C13H12BrNO4 — CID 113443048
4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]morpholine-3,5-dione (PubChem CID 113443048) has the molecular formula C13H12BrNO4 and a molecular weight of 326.15 g/mol. Its IUPAC name is 4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]morpholine-3,5-dione.
| Compound Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]morpholine-3,5-dione |
|---|---|
| PubChem CID | 113443048 |
| Molecular Formula | C13H12BrNO4 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | 4-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]morpholine-3,5-dione |
| SMILES | O=C1COCC(=O)N1Cc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C13H12BrNO4/c14-10-3-8-1-2-19-13(8)9(4-10)5-15-11(16)6-18-7-12(15)17/h3-4H,1-2,5-7H2 |
| InChIKey | ORZSHEHCBKHDIE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|