C9H8BrN3O — CID 22930437
7-(azidomethyl)-5-bromo-2,3-dihydro-1-benzofuran (PubChem CID 22930437) has the molecular formula C9H8BrN3O and a molecular weight of 254.09 g/mol. Its IUPAC name is 7-(azidomethyl)-5-bromo-2,3-dihydro-1-benzofuran.
| Compound Name | 7-(azidomethyl)-5-bromo-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 22930437 |
| Molecular Formula | C9H8BrN3O |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | 7-(azidomethyl)-5-bromo-2,3-dihydro-1-benzofuran |
| SMILES | [N-]=[N+]=NCc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C9H8BrN3O/c10-8-3-6-1-2-14-9(6)7(4-8)5-12-13-11/h3-4H,1-2,5H2 |
| InChIKey | VDOVVBKZFBZVRM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|