C15H19BrN2OS — CID 136716850
N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-ethyl-4-methyl-1,3-thiazolidin-2-imine (PubChem CID 136716850) has the molecular formula C15H19BrN2OS and a molecular weight of 355.30 g/mol. Its IUPAC name is N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-ethyl-4-methyl-1,3-thiazolidin-2-imine.
| Compound Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-ethyl-4-methyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136716850 |
| Molecular Formula | C15H19BrN2OS |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-4-ethyl-4-methyl-1,3-thiazolidin-2-imine |
| SMILES | CCC1(C)CS/C(=N\Cc2cc(Br)cc3c2OCC3)N1 |
| InChI | InChI=1S/C15H19BrN2OS/c1-3-15(2)9-20-14(18-15)17-8-11-7-12(16)6-10-4-5-19-13(10)11/h6-7H,3-5,8-9H2,1-2H3,(H,17,18) |
| InChIKey | QHOPNXIUDFRMQO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|