C13H21Br2N3O — CID 114780668
4-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine (PubChem CID 114780668) has the molecular formula C13H21Br2N3O and a molecular weight of 395.14 g/mol. Its IUPAC name is 4-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine.
| Compound Name | 4-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 114780668 |
| Molecular Formula | C13H21Br2N3O |
| Molecular Weight | 395.14 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 4-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-6-(bromomethyl)-2,2-dimethylmorpholine |
| SMILES | Cc1nn(C)c(CN2CC(CBr)OC(C)(C)C2)c1Br |
| InChI | InChI=1S/C13H21Br2N3O/c1-9-12(15)11(17(4)16-9)7-18-6-10(5-14)19-13(2,3)8-18/h10H,5-8H2,1-4H3 |
| InChIKey | RTMIBZCITQCMOL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|