C13H19NO4 — CID 106321907
cis-(1R,3S)-3-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)cyclopentane-1-carboxylic acid (PubChem CID 106321907) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is cis-(1R,3S)-3-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106321907 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | cis-(1R,3S)-3-(4,4-dimethyl-2,6-dioxopiperidin-1-yl)cyclopentane-1-carboxylic acid |
| SMILES | CC1(C)CC(=O)N([C@H]2CC[C@@H](C(=O)O)C2)C(=O)C1 |
| InChI | InChI=1S/C13H19NO4/c1-13(2)6-10(15)14(11(16)7-13)9-4-3-8(5-9)12(17)18/h8-9H,3-7H2,1-2H3,(H,17,18)/t8-,9+/m1/s1 |
| InChIKey | XFVNVCYEPVUQPE-BDAKNGLRSA-N |
| XLogP | 1.41 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|