About CID 10632277
CID 10632277 (PubChem CID 10632277) has the molecular formula C13H25Si
and a molecular weight of 209.43 g/mol.
Molecular Properties
| Compound Name | CID 10632277 |
| PubChem CID | 10632277 |
| Molecular Formula | C13H25Si |
| Molecular Weight | 209.43 g/mol |
| Exact Mass | 209.17 |
| IUPAC Name | — |
| SMILES | CCCCCCC#CCCC[Si](C)C |
| InChI | InChI=1S/C13H25Si/c1-4-5-6-7-8-9-10-11-12-13-14(2)3/h4-8,11-13H2,1-3H3 |
| InChIKey | ZKLHFISZMGCESG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 10632277 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10632277?
The IUPAC name of CID 10632277 (CID 10632277) is not available.
What is the SMILES notation for CID 10632277?
The canonical SMILES for CID 10632277 is CCCCCCC#CCCC[Si](C)C.
What is the InChIKey of CID 10632277?
The InChIKey is ZKLHFISZMGCESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25Si/c1-4-5-6-7-8-9-10-11-12-13-14(2)3/h4-8,11-13H2,1-3H3.
What are the key properties of CID 10632277?
CID 10632277 has a molecular weight of 209.43 g/mol, XLogP of 4.49, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10632277 is sourced from PubChem (CID 10632277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).