C9H20O2Si — CID 106322957
2-methyl-2-(trimethylsilylmethyl)butanoic acid (PubChem CID 106322957) has the molecular formula C9H20O2Si and a molecular weight of 188.34 g/mol. Its IUPAC name is 2-methyl-2-(trimethylsilylmethyl)butanoic acid.
| Compound Name | 2-methyl-2-(trimethylsilylmethyl)butanoic acid |
|---|---|
| PubChem CID | 106322957 |
| Molecular Formula | C9H20O2Si |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-methyl-2-(trimethylsilylmethyl)butanoic acid |
| SMILES | CCC(C)(C[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H20O2Si/c1-6-9(2,8(10)11)7-12(3,4)5/h6-7H2,1-5H3,(H,10,11) |
| InChIKey | CGGYRXYXMGLLIP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|