C10H19BrO2 — CID 130468141
4-bromo-2-ethyl-2,4-dimethylhexanoic acid (PubChem CID 130468141) has the molecular formula C10H19BrO2 and a molecular weight of 251.16 g/mol. Its IUPAC name is 4-bromo-2-ethyl-2,4-dimethylhexanoic acid.
| Compound Name | 4-bromo-2-ethyl-2,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 130468141 |
| Molecular Formula | C10H19BrO2 |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-bromo-2-ethyl-2,4-dimethylhexanoic acid |
| SMILES | CCC(C)(Br)CC(C)(CC)C(=O)O |
| InChI | InChI=1S/C10H19BrO2/c1-5-9(3,8(12)13)7-10(4,11)6-2/h5-7H2,1-4H3,(H,12,13) |
| InChIKey | QMHMZRIQHLSYDQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|