About cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate
cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate (PubChem CID 106323850) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate.
Analyze cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate?
The IUPAC name of cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate (CID 106323850) is cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate.
What is the SMILES notation for cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate?
The canonical SMILES for cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate is N[C@H]1CC[C@@H](C(=O)OCC2CCOCC2)C1.
What is the InChIKey of cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate?
The InChIKey is XWGTWINNLHNKLR-MNOVXSKESA-N. The full InChI is InChI=1S/C12H21NO3/c13-11-2-1-10(7-11)12(14)16-8-9-3-5-15-6-4-9/h9-11H,1-8,13H2/t10-,11+/m1/s1.
What are the key properties of cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate?
cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate has a molecular weight of 227.30 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-oxan-4-ylmethyl (1R,3S)-3-aminocyclopentane-1-carboxylate is sourced from PubChem (CID 106323850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).