C11H20N4O3S — CID 106332688
4-amino-N-[2-(methylsulfamoyl)ethyl]-1-propylpyrrole-2-carboxamide (PubChem CID 106332688) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-amino-N-[2-(methylsulfamoyl)ethyl]-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[2-(methylsulfamoyl)ethyl]-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 106332688 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-amino-N-[2-(methylsulfamoyl)ethyl]-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(N)cc1C(=O)NCCS(=O)(=O)NC |
| InChI | InChI=1S/C11H20N4O3S/c1-3-5-15-8-9(12)7-10(15)11(16)14-4-6-19(17,18)13-2/h7-8,13H,3-6,12H2,1-2H3,(H,14,16) |
| InChIKey | XJVWLYNOKSPJCJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |