C11H19N5O2 — CID 83107929
4-amino-N-[2-(carbamoylamino)ethyl]-1-propylpyrrole-2-carboxamide (PubChem CID 83107929) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-amino-N-[2-(carbamoylamino)ethyl]-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-amino-N-[2-(carbamoylamino)ethyl]-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 83107929 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-amino-N-[2-(carbamoylamino)ethyl]-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(N)cc1C(=O)NCCNC(N)=O |
| InChI | InChI=1S/C11H19N5O2/c1-2-5-16-7-8(12)6-9(16)10(17)14-3-4-15-11(13)18/h6-7H,2-5,12H2,1H3,(H,14,17)(H3,13,15,18) |
| InChIKey | PYJALERAFNZTPT-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|