C8H15N5O3S — CID 106332824
3-amino-N-[2-(ethylsulfamoyl)ethyl]-1H-pyrazole-5-carboxamide (PubChem CID 106332824) has the molecular formula C8H15N5O3S and a molecular weight of 261.31 g/mol. Its IUPAC name is 3-amino-N-[2-(ethylsulfamoyl)ethyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-amino-N-[2-(ethylsulfamoyl)ethyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 106332824 |
| Molecular Formula | C8H15N5O3S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-amino-N-[2-(ethylsulfamoyl)ethyl]-1H-pyrazole-5-carboxamide |
| SMILES | CCNS(=O)(=O)CCNC(=O)c1cc(N)n[nH]1 |
| InChI | InChI=1S/C8H15N5O3S/c1-2-11-17(15,16)4-3-10-8(14)6-5-7(9)13-12-6/h5,11H,2-4H2,1H3,(H,10,14)(H3,9,12,13) |
| InChIKey | OYNDTGBMNDMSPF-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |