C13H24N2O5S — CID 106334798
1-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]cyclohexane-1-carboxylic acid (PubChem CID 106334798) has the molecular formula C13H24N2O5S and a molecular weight of 320.41 g/mol. Its IUPAC name is 1-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106334798 |
| Molecular Formula | C13H24N2O5S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-[2-[2-(dimethylsulfamoyl)ethylamino]-2-oxoethyl]cyclohexane-1-carboxylic acid |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)CC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C13H24N2O5S/c1-15(2)21(19,20)9-8-14-11(16)10-13(12(17)18)6-4-3-5-7-13/h3-10H2,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | ULORRILJOMPOKB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |