C12H22N2O5S — CID 43546068
1-[2-[2-(methanesulfonamido)ethylamino]-2-oxoethyl]cyclohexane-1-carboxylic acid (PubChem CID 43546068) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is 1-[2-[2-(methanesulfonamido)ethylamino]-2-oxoethyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[2-[2-(methanesulfonamido)ethylamino]-2-oxoethyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 43546068 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[2-[2-(methanesulfonamido)ethylamino]-2-oxoethyl]cyclohexane-1-carboxylic acid |
| SMILES | CS(=O)(=O)NCCNC(=O)CC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C12H22N2O5S/c1-20(18,19)14-8-7-13-10(15)9-12(11(16)17)5-3-2-4-6-12/h14H,2-9H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | GWNWUHVUAHQIST-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|