C11H26N2O2S — CID 106335163
N,N-dimethyl-2-(5-methylhexan-2-ylamino)ethanesulfonamide (PubChem CID 106335163) has the molecular formula C11H26N2O2S and a molecular weight of 250.41 g/mol. Its IUPAC name is N,N-dimethyl-2-(5-methylhexan-2-ylamino)ethanesulfonamide.
| Compound Name | N,N-dimethyl-2-(5-methylhexan-2-ylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 106335163 |
| Molecular Formula | C11H26N2O2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N,N-dimethyl-2-(5-methylhexan-2-ylamino)ethanesulfonamide |
| SMILES | CC(C)CCC(C)NCCS(=O)(=O)N(C)C |
| InChI | InChI=1S/C11H26N2O2S/c1-10(2)6-7-11(3)12-8-9-16(14,15)13(4)5/h10-12H,6-9H2,1-5H3 |
| InChIKey | GWQLTOSLKNQYPB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |